About 6-fluoropyridin-3-amine;6-pyrazol-1-ylpyridin-3-amine
6-fluoropyridin-3-amine;6-pyrazol-1-ylpyridin-3-amine (PubChem CID 161230547) has the molecular formula C13H13FN6
and a molecular weight of 272.29 g/mol. Its IUPAC name is 6-fluoropyridin-3-amine;6-pyrazol-1-ylpyridin-3-amine.
Molecular Properties
| Compound Name | 6-fluoropyridin-3-amine;6-pyrazol-1-ylpyridin-3-amine |
| PubChem CID | 161230547 |
| Molecular Formula | C13H13FN6 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 6-fluoropyridin-3-amine;6-pyrazol-1-ylpyridin-3-amine |
| SMILES | Nc1ccc(-n2cccn2)nc1.Nc1ccc(F)nc1 |
| InChI | InChI=1S/C8H8N4.C5H5FN2/c9-7-2-3-8(10-6-7)12-5-1-4-11-12;6-5-2-1-4(7)3-8-5/h1-6H,9H2;1-3H,7H2 |
| InChIKey | UYRUPGHGSNJOIS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoropyridin-3-amine;6-pyrazol-1-ylpyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoropyridin-3-amine;6-pyrazol-1-ylpyridin-3-amine?
The IUPAC name of 6-fluoropyridin-3-amine;6-pyrazol-1-ylpyridin-3-amine (CID 161230547) is 6-fluoropyridin-3-amine;6-pyrazol-1-ylpyridin-3-amine.
What is the SMILES notation for 6-fluoropyridin-3-amine;6-pyrazol-1-ylpyridin-3-amine?
The canonical SMILES for 6-fluoropyridin-3-amine;6-pyrazol-1-ylpyridin-3-amine is Nc1ccc(-n2cccn2)nc1.Nc1ccc(F)nc1.
What is the InChIKey of 6-fluoropyridin-3-amine;6-pyrazol-1-ylpyridin-3-amine?
The InChIKey is UYRUPGHGSNJOIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4.C5H5FN2/c9-7-2-3-8(10-6-7)12-5-1-4-11-12;6-5-2-1-4(7)3-8-5/h1-6H,9H2;1-3H,7H2.
What are the key properties of 6-fluoropyridin-3-amine;6-pyrazol-1-ylpyridin-3-amine?
6-fluoropyridin-3-amine;6-pyrazol-1-ylpyridin-3-amine has a molecular weight of 272.29 g/mol, XLogP of 1.65, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoropyridin-3-amine;6-pyrazol-1-ylpyridin-3-amine is sourced from PubChem (CID 161230547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).