C39H49FN4O6 — CID 161230792
1-[(E)-but-2-enyl]-6-(3,5-dimethylbenzoyl)-5-propan-2-ylpyrimidine-2,4-dione;6-[(3,5-dimethylphenyl)-fluoromethyl]-1-(ethoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione (PubChem CID 161230792) has the molecular formula C39H49FN4O6 and a molecular weight of 688.84 g/mol. Its IUPAC name is 1-[(E)-but-2-enyl]-6-(3,5-dimethylbenzoyl)-5-propan-2-ylpyrimidine-2,4-dione;6-[(3,5-dimethylphenyl)-fluoromethyl]-1-(ethoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione.
| Compound Name | 1-[(E)-but-2-enyl]-6-(3,5-dimethylbenzoyl)-5-propan-2-ylpyrimidine-2,4-dione;6-[(3,5-dimethylphenyl)-fluoromethyl]-1-(ethoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 161230792 |
| Molecular Formula | C39H49FN4O6 |
| Molecular Weight | 688.84 g/mol |
| Exact Mass | 688.36 |
| IUPAC Name | 1-[(E)-but-2-enyl]-6-(3,5-dimethylbenzoyl)-5-propan-2-ylpyrimidine-2,4-dione;6-[(3,5-dimethylphenyl)-fluoromethyl]-1-(ethoxymethyl)-5-propan-2-ylpyrimidine-2,4-dione |
| SMILES | C/C=C/Cn1c(C(=O)c2cc(C)cc(C)c2)c(C(C)C)c(=O)[nH]c1=O.CCOCn1c(C(F)c2cc(C)cc(C)c2)c(C(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H24N2O3.C19H25FN2O3/c1-6-7-8-22-17(16(12(2)3)19(24)21-20(22)25)18(23)15-10-13(4)9-14(5)11-15;1-6-25-10-22-17(15(11(2)3)18(23)21-19(22)24)16(20)14-8-12(4)7-13(5)9-14/h6-7,9-12H,8H2,1-5H3,(H,21,24,25);7-9,11,16H,6,10H2,1-5H3,(H,21,23,24)/b7-6+; |
| InChIKey | UYSLMNAQQRWDOG-UHDJGPCESA-N |
| XLogP | 6.41 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.84 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|