About 1-cyclohexylcyclohexa-2,4-dien-1-ol;propan-2-one
1-cyclohexylcyclohexa-2,4-dien-1-ol;propan-2-one (PubChem CID 161232949) has the molecular formula C15H24O2
and a molecular weight of 236.35 g/mol. Its IUPAC name is 1-cyclohexylcyclohexa-2,4-dien-1-ol;propan-2-one.
Molecular Properties
| Compound Name | 1-cyclohexylcyclohexa-2,4-dien-1-ol;propan-2-one |
| PubChem CID | 161232949 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 1-cyclohexylcyclohexa-2,4-dien-1-ol;propan-2-one |
| SMILES | CC(C)=O.OC1(C2CCCCC2)C=CC=CC1 |
| InChI | InChI=1S/C12H18O.C3H6O/c13-12(9-5-2-6-10-12)11-7-3-1-4-8-11;1-3(2)4/h2,5-6,9,11,13H,1,3-4,7-8,10H2;1-2H3 |
| InChIKey | UYZNDWPPTZOFIB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclohexylcyclohexa-2,4-dien-1-ol;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylcyclohexa-2,4-dien-1-ol;propan-2-one?
The IUPAC name of 1-cyclohexylcyclohexa-2,4-dien-1-ol;propan-2-one (CID 161232949) is 1-cyclohexylcyclohexa-2,4-dien-1-ol;propan-2-one.
What is the SMILES notation for 1-cyclohexylcyclohexa-2,4-dien-1-ol;propan-2-one?
The canonical SMILES for 1-cyclohexylcyclohexa-2,4-dien-1-ol;propan-2-one is CC(C)=O.OC1(C2CCCCC2)C=CC=CC1.
What is the InChIKey of 1-cyclohexylcyclohexa-2,4-dien-1-ol;propan-2-one?
The InChIKey is UYZNDWPPTZOFIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O.C3H6O/c13-12(9-5-2-6-10-12)11-7-3-1-4-8-11;1-3(2)4/h2,5-6,9,11,13H,1,3-4,7-8,10H2;1-2H3.
What are the key properties of 1-cyclohexylcyclohexa-2,4-dien-1-ol;propan-2-one?
1-cyclohexylcyclohexa-2,4-dien-1-ol;propan-2-one has a molecular weight of 236.35 g/mol, XLogP of 3.41, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylcyclohexa-2,4-dien-1-ol;propan-2-one is sourced from PubChem (CID 161232949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).