C12H4N4O2S2 — CID 161233548
1,4-bis(1,3-thiazol-4-yl)pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 161233548) has the molecular formula C12H4N4O2S2 and a molecular weight of 300.32 g/mol. Its IUPAC name is 1,4-bis(1,3-thiazol-4-yl)pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 1,4-bis(1,3-thiazol-4-yl)pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 161233548 |
| Molecular Formula | C12H4N4O2S2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 1,4-bis(1,3-thiazol-4-yl)pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | O=c1nc(-c2cscn2)c2c(=O)nc(-c3cscn3)c1=2 |
| InChI | InChI=1S/C12H4N4O2S2/c17-11-7-8(10(16-11)6-2-20-4-14-6)12(18)15-9(7)5-1-19-3-13-5/h1-4H |
| InChIKey | UZBMPEFLPBNUKK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 85.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |