About 2-(diethylamino)ethanethiol;2-(dimethylamino)ethanethiol;propane-1-thiol
2-(diethylamino)ethanethiol;2-(dimethylamino)ethanethiol;propane-1-thiol (PubChem CID 161234762) has the molecular formula C13H34N2S3
and a molecular weight of 314.63 g/mol. Its IUPAC name is 2-(diethylamino)ethanethiol;2-(dimethylamino)ethanethiol;propane-1-thiol.
Molecular Properties
| Compound Name | 2-(diethylamino)ethanethiol;2-(dimethylamino)ethanethiol;propane-1-thiol |
| PubChem CID | 161234762 |
| Molecular Formula | C13H34N2S3 |
| Molecular Weight | 314.63 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 2-(diethylamino)ethanethiol;2-(dimethylamino)ethanethiol;propane-1-thiol |
| SMILES | CCCS.CCN(CC)CCS.CN(C)CCS |
| InChI | InChI=1S/C6H15NS.C4H11NS.C3H8S/c1-3-7(4-2)5-6-8;1-5(2)3-4-6;1-2-3-4/h8H,3-6H2,1-2H3;6H,3-4H2,1-2H3;4H,2-3H2,1H3 |
| InChIKey | UZFNIFADJLDQNJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.63 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)ethanethiol;2-(dimethylamino)ethanethiol;propane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethanethiol;2-(dimethylamino)ethanethiol;propane-1-thiol?
The IUPAC name of 2-(diethylamino)ethanethiol;2-(dimethylamino)ethanethiol;propane-1-thiol (CID 161234762) is 2-(diethylamino)ethanethiol;2-(dimethylamino)ethanethiol;propane-1-thiol.
What is the SMILES notation for 2-(diethylamino)ethanethiol;2-(dimethylamino)ethanethiol;propane-1-thiol?
The canonical SMILES for 2-(diethylamino)ethanethiol;2-(dimethylamino)ethanethiol;propane-1-thiol is CCCS.CCN(CC)CCS.CN(C)CCS.
What is the InChIKey of 2-(diethylamino)ethanethiol;2-(dimethylamino)ethanethiol;propane-1-thiol?
The InChIKey is UZFNIFADJLDQNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NS.C4H11NS.C3H8S/c1-3-7(4-2)5-6-8;1-5(2)3-4-6;1-2-3-4/h8H,3-6H2,1-2H3;6H,3-4H2,1-2H3;4H,2-3H2,1H3.
What are the key properties of 2-(diethylamino)ethanethiol;2-(dimethylamino)ethanethiol;propane-1-thiol?
2-(diethylamino)ethanethiol;2-(dimethylamino)ethanethiol;propane-1-thiol has a molecular weight of 314.63 g/mol, XLogP of 3.06, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethanethiol;2-(dimethylamino)ethanethiol;propane-1-thiol is sourced from PubChem (CID 161234762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).