About bicyclo[4.2.0]octa-1,3,5-triene;9H-fluorene
bicyclo[4.2.0]octa-1,3,5-triene;9H-fluorene (PubChem CID 161235205) has the molecular formula C21H18
and a molecular weight of 270.38 g/mol. Its IUPAC name is bicyclo[4.2.0]octa-1,3,5-triene;9H-fluorene.
Molecular Properties
| Compound Name | bicyclo[4.2.0]octa-1,3,5-triene;9H-fluorene |
| PubChem CID | 161235205 |
| Molecular Formula | C21H18 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | bicyclo[4.2.0]octa-1,3,5-triene;9H-fluorene |
| SMILES | c1ccc2c(c1)CC2.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.C8H8/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2-4-8-6-5-7(8)3-1/h1-8H,9H2;1-4H,5-6H2 |
| InChIKey | UZGUMDUZRHQUHU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bicyclo[4.2.0]octa-1,3,5-triene;9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[4.2.0]octa-1,3,5-triene;9H-fluorene?
The IUPAC name of bicyclo[4.2.0]octa-1,3,5-triene;9H-fluorene (CID 161235205) is bicyclo[4.2.0]octa-1,3,5-triene;9H-fluorene.
What is the SMILES notation for bicyclo[4.2.0]octa-1,3,5-triene;9H-fluorene?
The canonical SMILES for bicyclo[4.2.0]octa-1,3,5-triene;9H-fluorene is c1ccc2c(c1)CC2.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of bicyclo[4.2.0]octa-1,3,5-triene;9H-fluorene?
The InChIKey is UZGUMDUZRHQUHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C8H8/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2-4-8-6-5-7(8)3-1/h1-8H,9H2;1-4H,5-6H2.
What are the key properties of bicyclo[4.2.0]octa-1,3,5-triene;9H-fluorene?
bicyclo[4.2.0]octa-1,3,5-triene;9H-fluorene has a molecular weight of 270.38 g/mol, XLogP of 5.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[4.2.0]octa-1,3,5-triene;9H-fluorene is sourced from PubChem (CID 161235205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).