C25H28N2O3S — CID 161235906
6-(4-hydroxybutyl)-2-(3-naphthalen-2-yl-2-oxopropyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide (PubChem CID 161235906) has the molecular formula C25H28N2O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is 6-(4-hydroxybutyl)-2-(3-naphthalen-2-yl-2-oxopropyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide.
| Compound Name | 6-(4-hydroxybutyl)-2-(3-naphthalen-2-yl-2-oxopropyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 161235906 |
| Molecular Formula | C25H28N2O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 6-(4-hydroxybutyl)-2-(3-naphthalen-2-yl-2-oxopropyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide |
| SMILES | NC(=O)c1c(CC(=O)Cc2ccc3ccccc3c2)sc2c1CCN(CCCCO)C2 |
| InChI | InChI=1S/C25H28N2O3S/c26-25(30)24-21-9-11-27(10-3-4-12-28)16-23(21)31-22(24)15-20(29)14-17-7-8-18-5-1-2-6-19(18)13-17/h1-2,5-8,13,28H,3-4,9-12,14-16H2,(H2,26,30) |
| InChIKey | UZJDNOCJBKZTFQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|