C36H31ClN6O3 — CID 161236094
N-[5-chloro-2-oxo-1-[4-[[4-(5-oxo-3-phenyl-6H-1,6-naphthyridin-2-yl)phenyl]methyl]piperazin-1-yl]-3H-indol-6-yl]prop-2-enamide (PubChem CID 161236094) has the molecular formula C36H31ClN6O3 and a molecular weight of 631.14 g/mol. Its IUPAC name is N-[5-chloro-2-oxo-1-[4-[[4-(5-oxo-3-phenyl-6H-1,6-naphthyridin-2-yl)phenyl]methyl]piperazin-1-yl]-3H-indol-6-yl]prop-2-enamide.
| Compound Name | N-[5-chloro-2-oxo-1-[4-[[4-(5-oxo-3-phenyl-6H-1,6-naphthyridin-2-yl)phenyl]methyl]piperazin-1-yl]-3H-indol-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 161236094 |
| Molecular Formula | C36H31ClN6O3 |
| Molecular Weight | 631.14 g/mol |
| Exact Mass | 630.21 |
| IUPAC Name | N-[5-chloro-2-oxo-1-[4-[[4-(5-oxo-3-phenyl-6H-1,6-naphthyridin-2-yl)phenyl]methyl]piperazin-1-yl]-3H-indol-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2c(cc1Cl)CC(=O)N2N1CCN(Cc2ccc(-c3nc4cc[nH]c(=O)c4cc3-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C36H31ClN6O3/c1-2-33(44)39-31-21-32-26(18-29(31)37)19-34(45)43(32)42-16-14-41(15-17-42)22-23-8-10-25(11-9-23)35-27(24-6-4-3-5-7-24)20-28-30(40-35)12-13-38-36(28)46/h2-13,18,20-21H,1,14-17,19,22H2,(H,38,46)(H,39,44) |
| InChIKey | QLJHETKGZADPRT-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.14 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|