C27H19F2I3O6S2 — CID 161238063
1,1-difluoro-2-(2-hydroxy-3,5-diiodobenzoyl)oxyethanesulfonate;(4-iodophenyl)-diphenylsulfanium (PubChem CID 161238063) has the molecular formula C27H19F2I3O6S2 and a molecular weight of 922.28 g/mol. Its IUPAC name is 1,1-difluoro-2-(2-hydroxy-3,5-diiodobenzoyl)oxyethanesulfonate;(4-iodophenyl)-diphenylsulfanium.
| Compound Name | 1,1-difluoro-2-(2-hydroxy-3,5-diiodobenzoyl)oxyethanesulfonate;(4-iodophenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 161238063 |
| Molecular Formula | C27H19F2I3O6S2 |
| Molecular Weight | 922.28 g/mol |
| Exact Mass | 921.77 |
| IUPAC Name | 1,1-difluoro-2-(2-hydroxy-3,5-diiodobenzoyl)oxyethanesulfonate;(4-iodophenyl)-diphenylsulfanium |
| SMILES | Ic1ccc([S+](c2ccccc2)c2ccccc2)cc1.O=C(OCC(F)(F)S(=O)(=O)[O-])c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C18H14IS.C9H6F2I2O6S/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17;10-9(11,20(16,17)18)3-19-8(15)5-1-4(12)2-6(13)7(5)14/h1-14H;1-2,14H,3H2,(H,16,17,18)/q+1;/p-1 |
| InChIKey | UZQCXVRXUKZKNG-UHFFFAOYSA-M |
| XLogP | 7.28 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.28 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|