About 2-methylbutane;2H-tetrazole
2-methylbutane;2H-tetrazole (PubChem CID 161238291) has the molecular formula C6H14N4
and a molecular weight of 142.21 g/mol. Its IUPAC name is 2-methylbutane;2H-tetrazole.
Molecular Properties
| Compound Name | 2-methylbutane;2H-tetrazole |
| PubChem CID | 161238291 |
| Molecular Formula | C6H14N4 |
| Molecular Weight | 142.21 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | 2-methylbutane;2H-tetrazole |
| SMILES | CCC(C)C.c1nn[nH]n1 |
| InChI | InChI=1S/C5H12.CH2N4/c1-4-5(2)3;1-2-4-5-3-1/h5H,4H2,1-3H3;1H,(H,2,3,4,5) |
| InChIKey | UZQUINZZLGZROP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylbutane;2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutane;2H-tetrazole?
The IUPAC name of 2-methylbutane;2H-tetrazole (CID 161238291) is 2-methylbutane;2H-tetrazole.
What is the SMILES notation for 2-methylbutane;2H-tetrazole?
The canonical SMILES for 2-methylbutane;2H-tetrazole is CCC(C)C.c1nn[nH]n1.
What is the InChIKey of 2-methylbutane;2H-tetrazole?
The InChIKey is UZQUINZZLGZROP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12.CH2N4/c1-4-5(2)3;1-2-4-5-3-1/h5H,4H2,1-3H3;1H,(H,2,3,4,5).
What are the key properties of 2-methylbutane;2H-tetrazole?
2-methylbutane;2H-tetrazole has a molecular weight of 142.21 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutane;2H-tetrazole is sourced from PubChem (CID 161238291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).