C13H23ClF3NO3S — CID 161238307
[(3S)-3-ethyl-4-oxopentyl]-[2-hydroxy-3-[(2,2,2-trifluoroacetyl)amino]propyl]-methylsulfanium chloride (PubChem CID 161238307) has the molecular formula C13H23ClF3NO3S and a molecular weight of 365.85 g/mol. Its IUPAC name is [(3S)-3-ethyl-4-oxopentyl]-[2-hydroxy-3-[(2,2,2-trifluoroacetyl)amino]propyl]-methylsulfanium chloride.
| Compound Name | [(3S)-3-ethyl-4-oxopentyl]-[2-hydroxy-3-[(2,2,2-trifluoroacetyl)amino]propyl]-methylsulfanium chloride |
|---|---|
| PubChem CID | 161238307 |
| Molecular Formula | C13H23ClF3NO3S |
| Molecular Weight | 365.85 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | [(3S)-3-ethyl-4-oxopentyl]-[2-hydroxy-3-[(2,2,2-trifluoroacetyl)amino]propyl]-methylsulfanium chloride |
| SMILES | CC[C@@H](CC[S+](C)CC(O)CNC(=O)C(F)(F)F)C(C)=O.[Cl-] |
| InChI | InChI=1S/C13H22F3NO3S.ClH/c1-4-10(9(2)18)5-6-21(3)8-11(19)7-17-12(20)13(14,15)16;/h10-11,19H,4-8H2,1-3H3;1H/t10-,11?,21?;/m0./s1 |
| InChIKey | KVVGLZPYAHBJNT-KTIAGTIISA-N |
| XLogP | -1.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.85 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|