About ethane;5-propan-2-yl-2,3-dihydro-1H-isoindole
ethane;5-propan-2-yl-2,3-dihydro-1H-isoindole (PubChem CID 161239828) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is ethane;5-propan-2-yl-2,3-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | ethane;5-propan-2-yl-2,3-dihydro-1H-isoindole |
| PubChem CID | 161239828 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | ethane;5-propan-2-yl-2,3-dihydro-1H-isoindole |
| SMILES | CC.CC.CC(C)c1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C11H15N.2C2H6/c1-8(2)9-3-4-10-6-12-7-11(10)5-9;2*1-2/h3-5,8,12H,6-7H2,1-2H3;2*1-2H3 |
| InChIKey | UZVTVEUKXBSWRU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;5-propan-2-yl-2,3-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-propan-2-yl-2,3-dihydro-1H-isoindole?
The IUPAC name of ethane;5-propan-2-yl-2,3-dihydro-1H-isoindole (CID 161239828) is ethane;5-propan-2-yl-2,3-dihydro-1H-isoindole.
What is the SMILES notation for ethane;5-propan-2-yl-2,3-dihydro-1H-isoindole?
The canonical SMILES for ethane;5-propan-2-yl-2,3-dihydro-1H-isoindole is CC.CC.CC(C)c1ccc2c(c1)CNC2.
What is the InChIKey of ethane;5-propan-2-yl-2,3-dihydro-1H-isoindole?
The InChIKey is UZVTVEUKXBSWRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.2C2H6/c1-8(2)9-3-4-10-6-12-7-11(10)5-9;2*1-2/h3-5,8,12H,6-7H2,1-2H3;2*1-2H3.
What are the key properties of ethane;5-propan-2-yl-2,3-dihydro-1H-isoindole?
ethane;5-propan-2-yl-2,3-dihydro-1H-isoindole has a molecular weight of 221.39 g/mol, XLogP of 4.47, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-propan-2-yl-2,3-dihydro-1H-isoindole is sourced from PubChem (CID 161239828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).