C15H27N — CID 161239828
ethane;5-propan-2-yl-2,3-dihydro-1H-isoindole (PubChem CID 161239828) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is ethane;5-propan-2-yl-2,3-dihydro-1H-isoindole.
| Compound Name | ethane;5-propan-2-yl-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 161239828 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | ethane;5-propan-2-yl-2,3-dihydro-1H-isoindole |
| SMILES | CC.CC.CC(C)c1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C11H15N.2C2H6/c1-8(2)9-3-4-10-6-12-7-11(10)5-9;2*1-2/h3-5,8,12H,6-7H2,1-2H3;2*1-2H3 |
| InChIKey | UZVTVEUKXBSWRU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |