C28H35BrN4O3S2 — CID 161240284
2-bromo-1-(4-pentylphenyl)ethanone;6-(4-pentylphenyl)imidazo[2,1-b][1,3,4]thiadiazole-2-sulfonamide (PubChem CID 161240284) has the molecular formula C28H35BrN4O3S2 and a molecular weight of 619.65 g/mol. Its IUPAC name is 2-bromo-1-(4-pentylphenyl)ethanone;6-(4-pentylphenyl)imidazo[2,1-b][1,3,4]thiadiazole-2-sulfonamide.
| Compound Name | 2-bromo-1-(4-pentylphenyl)ethanone;6-(4-pentylphenyl)imidazo[2,1-b][1,3,4]thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 161240284 |
| Molecular Formula | C28H35BrN4O3S2 |
| Molecular Weight | 619.65 g/mol |
| Exact Mass | 618.13 |
| IUPAC Name | 2-bromo-1-(4-pentylphenyl)ethanone;6-(4-pentylphenyl)imidazo[2,1-b][1,3,4]thiadiazole-2-sulfonamide |
| SMILES | CCCCCc1ccc(-c2cn3nc(S(N)(=O)=O)sc3n2)cc1.CCCCCc1ccc(C(=O)CBr)cc1 |
| InChI | InChI=1S/C15H18N4O2S2.C13H17BrO/c1-2-3-4-5-11-6-8-12(9-7-11)13-10-19-14(17-13)22-15(18-19)23(16,20)21;1-2-3-4-5-11-6-8-12(9-7-11)13(15)10-14/h6-10H,2-5H2,1H3,(H2,16,20,21);6-9H,2-5,10H2,1H3 |
| InChIKey | UZXFRQBHWHAYNF-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.65 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|