About 4-(1,2-dihydroazocin-2-yl)butanamide;hydrochloride
4-(1,2-dihydroazocin-2-yl)butanamide;hydrochloride (PubChem CID 161241343) has the molecular formula C11H17ClN2O
and a molecular weight of 228.72 g/mol. Its IUPAC name is 4-(1,2-dihydroazocin-2-yl)butanamide;hydrochloride.
Molecular Properties
| Compound Name | 4-(1,2-dihydroazocin-2-yl)butanamide;hydrochloride |
| PubChem CID | 161241343 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-(1,2-dihydroazocin-2-yl)butanamide;hydrochloride |
| SMILES | Cl.NC(=O)CCCC1C=CC=CC=CN1 |
| InChI | InChI=1S/C11H16N2O.ClH/c12-11(14)8-5-7-10-6-3-1-2-4-9-13-10;/h1-4,6,9-10,13H,5,7-8H2,(H2,12,14);1H |
| InChIKey | VAAWNRQFLKOKAA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(1,2-dihydroazocin-2-yl)butanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2-dihydroazocin-2-yl)butanamide;hydrochloride?
The IUPAC name of 4-(1,2-dihydroazocin-2-yl)butanamide;hydrochloride (CID 161241343) is 4-(1,2-dihydroazocin-2-yl)butanamide;hydrochloride.
What is the SMILES notation for 4-(1,2-dihydroazocin-2-yl)butanamide;hydrochloride?
The canonical SMILES for 4-(1,2-dihydroazocin-2-yl)butanamide;hydrochloride is Cl.NC(=O)CCCC1C=CC=CC=CN1.
What is the InChIKey of 4-(1,2-dihydroazocin-2-yl)butanamide;hydrochloride?
The InChIKey is VAAWNRQFLKOKAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O.ClH/c12-11(14)8-5-7-10-6-3-1-2-4-9-13-10;/h1-4,6,9-10,13H,5,7-8H2,(H2,12,14);1H.
What are the key properties of 4-(1,2-dihydroazocin-2-yl)butanamide;hydrochloride?
4-(1,2-dihydroazocin-2-yl)butanamide;hydrochloride has a molecular weight of 228.72 g/mol, XLogP of 1.66, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2-dihydroazocin-2-yl)butanamide;hydrochloride is sourced from PubChem (CID 161241343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).