C19H14N2 — CID 161241455
4-methyl-2-phenyl-1,10-phenanthroline (PubChem CID 161241455) has the molecular formula C19H14N2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 4-methyl-2-phenyl-1,10-phenanthroline.
| Compound Name | 4-methyl-2-phenyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 161241455 |
| Molecular Formula | C19H14N2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 4-methyl-2-phenyl-1,10-phenanthroline |
| SMILES | Cc1cc(-c2ccccc2)nc2c1ccc1cccnc12 |
| InChI | InChI=1S/C19H14N2/c1-13-12-17(14-6-3-2-4-7-14)21-19-16(13)10-9-15-8-5-11-20-18(15)19/h2-12H,1H3 |
| InChIKey | OVSSUCRJTQDHOB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|