About 3-nitro-6-(trideuteriomethoxy)pyridin-2-amine;6-(trideuteriomethoxy)pyridine-2,3-diamine
3-nitro-6-(trideuteriomethoxy)pyridin-2-amine;6-(trideuteriomethoxy)pyridine-2,3-diamine (PubChem CID 161242232) has the molecular formula C12H16N6O4
and a molecular weight of 314.33 g/mol. Its IUPAC name is 3-nitro-6-(trideuteriomethoxy)pyridin-2-amine;6-(trideuteriomethoxy)pyridine-2,3-diamine.
Molecular Properties
| Compound Name | 3-nitro-6-(trideuteriomethoxy)pyridin-2-amine;6-(trideuteriomethoxy)pyridine-2,3-diamine |
| PubChem CID | 161242232 |
| Molecular Formula | C12H16N6O4 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 3-nitro-6-(trideuteriomethoxy)pyridin-2-amine;6-(trideuteriomethoxy)pyridine-2,3-diamine |
| SMILES | [2H]C([2H])([2H])Oc1ccc(N)c(N)n1.[2H]C([2H])([2H])Oc1ccc([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C6H7N3O3.C6H9N3O/c1-12-5-3-2-4(9(10)11)6(7)8-5;1-10-5-3-2-4(7)6(8)9-5/h2-3H,1H3,(H2,7,8);2-3H,7H2,1H3,(H2,8,9)/i2*1D3 |
| InChIKey | VADYCUITWBBAND-RVWRRERJSA-N |
| XLogP | 0.84 |
| TPSA | 165.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-6-(trideuteriomethoxy)pyridin-2-amine;6-(trideuteriomethoxy)pyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-6-(trideuteriomethoxy)pyridin-2-amine;6-(trideuteriomethoxy)pyridine-2,3-diamine?
The IUPAC name of 3-nitro-6-(trideuteriomethoxy)pyridin-2-amine;6-(trideuteriomethoxy)pyridine-2,3-diamine (CID 161242232) is 3-nitro-6-(trideuteriomethoxy)pyridin-2-amine;6-(trideuteriomethoxy)pyridine-2,3-diamine.
What is the SMILES notation for 3-nitro-6-(trideuteriomethoxy)pyridin-2-amine;6-(trideuteriomethoxy)pyridine-2,3-diamine?
The canonical SMILES for 3-nitro-6-(trideuteriomethoxy)pyridin-2-amine;6-(trideuteriomethoxy)pyridine-2,3-diamine is [2H]C([2H])([2H])Oc1ccc(N)c(N)n1.[2H]C([2H])([2H])Oc1ccc([N+](=O)[O-])c(N)n1.
What is the InChIKey of 3-nitro-6-(trideuteriomethoxy)pyridin-2-amine;6-(trideuteriomethoxy)pyridine-2,3-diamine?
The InChIKey is VADYCUITWBBAND-RVWRRERJSA-N. The full InChI is InChI=1S/C6H7N3O3.C6H9N3O/c1-12-5-3-2-4(9(10)11)6(7)8-5;1-10-5-3-2-4(7)6(8)9-5/h2-3H,1H3,(H2,7,8);2-3H,7H2,1H3,(H2,8,9)/i2*1D3.
What are the key properties of 3-nitro-6-(trideuteriomethoxy)pyridin-2-amine;6-(trideuteriomethoxy)pyridine-2,3-diamine?
3-nitro-6-(trideuteriomethoxy)pyridin-2-amine;6-(trideuteriomethoxy)pyridine-2,3-diamine has a molecular weight of 314.33 g/mol, XLogP of 0.84, 5 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-6-(trideuteriomethoxy)pyridin-2-amine;6-(trideuteriomethoxy)pyridine-2,3-diamine is sourced from PubChem (CID 161242232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).