C21H21NO4S — CID 161242818
2-(benzenesulfonyl)-2-(7-methyl-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)propanoic acid (PubChem CID 161242818) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-2-(7-methyl-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)propanoic acid.
| Compound Name | 2-(benzenesulfonyl)-2-(7-methyl-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 161242818 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2-(benzenesulfonyl)-2-(7-methyl-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)propanoic acid |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CC(C(C)(C(=O)O)S(=O)(=O)c1ccccc1)C3 |
| InChI | InChI=1S/C21H21NO4S/c1-13-8-9-18-16(10-13)17-11-14(12-19(17)22-18)21(2,20(23)24)27(25,26)15-6-4-3-5-7-15/h3-10,14,22H,11-12H2,1-2H3,(H,23,24) |
| InChIKey | VAFWGANSAHADQJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|