C33H37F2O4S+ — CID 161243880
3-O-(2,2-difluoropropyl) 2-O-methyl 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate;triphenylsulfanium (PubChem CID 161243880) has the molecular formula C33H37F2O4S+ and a molecular weight of 567.72 g/mol. Its IUPAC name is 3-O-(2,2-difluoropropyl) 2-O-methyl 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate;triphenylsulfanium.
| Compound Name | 3-O-(2,2-difluoropropyl) 2-O-methyl 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate;triphenylsulfanium |
|---|---|
| PubChem CID | 161243880 |
| Molecular Formula | C33H37F2O4S+ |
| Molecular Weight | 567.72 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | 3-O-(2,2-difluoropropyl) 2-O-methyl 5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate;triphenylsulfanium |
| SMILES | COC(=O)C1C2CC(C(C)C2C)C1C(=O)OCC(C)(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C15H22F2O4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-8(2)10-5-9(7)11(13(18)20-4)12(10)14(19)21-6-15(3,16)17/h1-15H;7-12H,5-6H2,1-4H3/q+1; |
| InChIKey | VAJHAVOFNUFKOP-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.72 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|