C23H23ClF3N5O — CID 161244171
2-[[6-chloro-2-[3-[4-(trifluoromethyl)phenyl]propanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-4-yl]methyl]guanidine (PubChem CID 161244171) has the molecular formula C23H23ClF3N5O and a molecular weight of 477.92 g/mol. Its IUPAC name is 2-[[6-chloro-2-[3-[4-(trifluoromethyl)phenyl]propanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-4-yl]methyl]guanidine.
| Compound Name | 2-[[6-chloro-2-[3-[4-(trifluoromethyl)phenyl]propanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 161244171 |
| Molecular Formula | C23H23ClF3N5O |
| Molecular Weight | 477.92 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 2-[[6-chloro-2-[3-[4-(trifluoromethyl)phenyl]propanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-4-yl]methyl]guanidine |
| SMILES | NC(N)=NCC1CN(C(=O)CCc2ccc(C(F)(F)F)cc2)Cc2[nH]c3ccc(Cl)cc3c21 |
| InChI | InChI=1S/C23H23ClF3N5O/c24-16-6-7-18-17(9-16)21-14(10-30-22(28)29)11-32(12-19(21)31-18)20(33)8-3-13-1-4-15(5-2-13)23(25,26)27/h1-2,4-7,9,14,31H,3,8,10-12H2,(H4,28,29,30) |
| InChIKey | VAKDVTHFNRFXAR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.92 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|