C19H25N7 — CID 161246288
1-tert-butylbenzotriazole;3-tert-butyltriazolo[4,5-b]pyridine (PubChem CID 161246288) has the molecular formula C19H25N7 and a molecular weight of 351.46 g/mol. Its IUPAC name is 1-tert-butylbenzotriazole;3-tert-butyltriazolo[4,5-b]pyridine.
| Compound Name | 1-tert-butylbenzotriazole;3-tert-butyltriazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 161246288 |
| Molecular Formula | C19H25N7 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 1-tert-butylbenzotriazole;3-tert-butyltriazolo[4,5-b]pyridine |
| SMILES | CC(C)(C)n1nnc2ccccc21.CC(C)(C)n1nnc2cccnc21 |
| InChI | InChI=1S/C10H13N3.C9H12N4/c1-10(2,3)13-9-7-5-4-6-8(9)11-12-13;1-9(2,3)13-8-7(11-12-13)5-4-6-10-8/h4-7H,1-3H3;4-6H,1-3H3 |
| InChIKey | VARKJNXGLGHPHQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |