C42H52INO2 — CID 161246878
(2-amino-3,4,5-trimethylphenyl)-(2,3,4,5,6-pentamethylphenyl)methanone;(2-iodo-3,4,5-trimethylphenyl)-(2,3,4,5,6-pentamethylphenyl)methanone (PubChem CID 161246878) has the molecular formula C42H52INO2 and a molecular weight of 729.79 g/mol. Its IUPAC name is (2-amino-3,4,5-trimethylphenyl)-(2,3,4,5,6-pentamethylphenyl)methanone;(2-iodo-3,4,5-trimethylphenyl)-(2,3,4,5,6-pentamethylphenyl)methanone.
| Compound Name | (2-amino-3,4,5-trimethylphenyl)-(2,3,4,5,6-pentamethylphenyl)methanone;(2-iodo-3,4,5-trimethylphenyl)-(2,3,4,5,6-pentamethylphenyl)methanone |
|---|---|
| PubChem CID | 161246878 |
| Molecular Formula | C42H52INO2 |
| Molecular Weight | 729.79 g/mol |
| Exact Mass | 729.30 |
| IUPAC Name | (2-amino-3,4,5-trimethylphenyl)-(2,3,4,5,6-pentamethylphenyl)methanone;(2-iodo-3,4,5-trimethylphenyl)-(2,3,4,5,6-pentamethylphenyl)methanone |
| SMILES | Cc1cc(C(=O)c2c(C)c(C)c(C)c(C)c2C)c(I)c(C)c1C.Cc1cc(C(=O)c2c(C)c(C)c(C)c(C)c2C)c(N)c(C)c1C |
| InChI | InChI=1S/C21H25IO.C21H27NO/c2*1-10-9-18(20(22)17(8)11(10)2)21(23)19-15(6)13(4)12(3)14(5)16(19)7/h9H,1-8H3;9H,22H2,1-8H3 |
| InChIKey | VATFNPSMKCVZCE-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.79 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|