C33H64O12 — CID 161249306
3-[2-(2-carboxyethyl)-3-methylcyclohexyl]propanoic acid;bis(2-[2-(2-hydroperoxyethyl)cyclohexyl]acetic acid);molecular hydrogen (PubChem CID 161249306) has the molecular formula C33H64O12 and a molecular weight of 652.86 g/mol. Its IUPAC name is 3-[2-(2-carboxyethyl)-3-methylcyclohexyl]propanoic acid;bis(2-[2-(2-hydroperoxyethyl)cyclohexyl]acetic acid);molecular hydrogen.
| Compound Name | 3-[2-(2-carboxyethyl)-3-methylcyclohexyl]propanoic acid;bis(2-[2-(2-hydroperoxyethyl)cyclohexyl]acetic acid);molecular hydrogen |
|---|---|
| PubChem CID | 161249306 |
| Molecular Formula | C33H64O12 |
| Molecular Weight | 652.86 g/mol |
| Exact Mass | 652.44 |
| IUPAC Name | 3-[2-(2-carboxyethyl)-3-methylcyclohexyl]propanoic acid;bis(2-[2-(2-hydroperoxyethyl)cyclohexyl]acetic acid);molecular hydrogen |
| SMILES | CC1CCCC(CCC(=O)O)C1CCC(=O)O.O=C(O)CC1CCCCC1CCOO.O=C(O)CC1CCCCC1CCOO.[H][H].[H][H].[H][H] |
| InChI | InChI=1S/C13H22O4.2C10H18O4.3H2/c1-9-3-2-4-10(5-7-12(14)15)11(9)6-8-13(16)17;2*11-10(12)7-9-4-2-1-3-8(9)5-6-14-13;;;/h9-11H,2-8H2,1H3,(H,14,15)(H,16,17);2*8-9,13H,1-7H2,(H,11,12);3*1H |
| InChIKey | VBBCQWLETQMIBR-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 208.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.86 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|