C20H21NO5 — CID 161249759
5,5-diphenyl-4H-1,2-oxazole-3-carboxylic acid;ethyl acetate (PubChem CID 161249759) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is 5,5-diphenyl-4H-1,2-oxazole-3-carboxylic acid;ethyl acetate.
| Compound Name | 5,5-diphenyl-4H-1,2-oxazole-3-carboxylic acid;ethyl acetate |
|---|---|
| PubChem CID | 161249759 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 5,5-diphenyl-4H-1,2-oxazole-3-carboxylic acid;ethyl acetate |
| SMILES | CCOC(C)=O.O=C(O)C1=NOC(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C16H13NO3.C4H8O2/c18-15(19)14-11-16(20-17-14,12-7-3-1-4-8-12)13-9-5-2-6-10-13;1-3-6-4(2)5/h1-10H,11H2,(H,18,19);3H2,1-2H3 |
| InChIKey | VBCPZEDEHRIBAP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |