C15H16N2O5S2 — CID 161251287
ethyl 2-hydroxy-2-thiophen-3-ylethanimidate;5-thiophen-3-yl-1,3-oxazolidine-2,4-dione (PubChem CID 161251287) has the molecular formula C15H16N2O5S2 and a molecular weight of 368.44 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-thiophen-3-ylethanimidate;5-thiophen-3-yl-1,3-oxazolidine-2,4-dione.
| Compound Name | ethyl 2-hydroxy-2-thiophen-3-ylethanimidate;5-thiophen-3-yl-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 161251287 |
| Molecular Formula | C15H16N2O5S2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | ethyl 2-hydroxy-2-thiophen-3-ylethanimidate;5-thiophen-3-yl-1,3-oxazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(c2ccsc2)O1.[H]/N=C(\OCC)C(O)c1ccsc1 |
| InChI | InChI=1S/C8H11NO2S.C7H5NO3S/c1-2-11-8(9)7(10)6-3-4-12-5-6;9-6-5(11-7(10)8-6)4-1-2-12-3-4/h3-5,7,9-10H,2H2,1H3;1-3,5H,(H,8,9,10)/b9-8-; |
| InChIKey | VBHPLSZJVYFRJR-UOQXYWCXSA-N |
| XLogP | 2.85 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|