C19H23N3O3 — CID 161253554
2-phenylacetic acid;N-(1-pyridin-4-ylethylideneamino)butanamide (PubChem CID 161253554) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-phenylacetic acid;N-(1-pyridin-4-ylethylideneamino)butanamide.
| Compound Name | 2-phenylacetic acid;N-(1-pyridin-4-ylethylideneamino)butanamide |
|---|---|
| PubChem CID | 161253554 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 2-phenylacetic acid;N-(1-pyridin-4-ylethylideneamino)butanamide |
| SMILES | CCCC(=O)NN=C(C)c1ccncc1.O=C(O)Cc1ccccc1 |
| InChI | InChI=1S/C11H15N3O.C8H8O2/c1-3-4-11(15)14-13-9(2)10-5-7-12-8-6-10;9-8(10)6-7-4-2-1-3-5-7/h5-8H,3-4H2,1-2H3,(H,14,15);1-5H,6H2,(H,9,10) |
| InChIKey | VBPDVJXHJNSMHJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|