C16H18S7 — CID 161253560
10-methyl-8-(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dithiin-5-yl)-2,3,5,6-tetrahydrothieno[3,4-b][1,4,7]trithionine (PubChem CID 161253560) has the molecular formula C16H18S7 and a molecular weight of 434.79 g/mol. Its IUPAC name is 10-methyl-8-(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dithiin-5-yl)-2,3,5,6-tetrahydrothieno[3,4-b][1,4,7]trithionine.
| Compound Name | 10-methyl-8-(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dithiin-5-yl)-2,3,5,6-tetrahydrothieno[3,4-b][1,4,7]trithionine |
|---|---|
| PubChem CID | 161253560 |
| Molecular Formula | C16H18S7 |
| Molecular Weight | 434.79 g/mol |
| Exact Mass | 433.95 |
| IUPAC Name | 10-methyl-8-(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dithiin-5-yl)-2,3,5,6-tetrahydrothieno[3,4-b][1,4,7]trithionine |
| SMILES | Cc1sc(-c2sc(C)c3c2SCCS3)c2c1SCCSCCS2 |
| InChI | InChI=1S/C16H18S7/c1-9-11-13(20-6-4-17-3-5-18-11)15(22-9)16-14-12(10(2)23-16)19-7-8-21-14/h3-8H2,1-2H3 |
| InChIKey | NQEOWKOFRMKOTR-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.79 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |