C13H25N3O3 — CID 161254467
1,3-di(propan-2-yl)-1,3-diazinane-2,4,6-trione;propan-2-amine (PubChem CID 161254467) has the molecular formula C13H25N3O3 and a molecular weight of 271.36 g/mol. Its IUPAC name is 1,3-di(propan-2-yl)-1,3-diazinane-2,4,6-trione;propan-2-amine.
| Compound Name | 1,3-di(propan-2-yl)-1,3-diazinane-2,4,6-trione;propan-2-amine |
|---|---|
| PubChem CID | 161254467 |
| Molecular Formula | C13H25N3O3 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 1,3-di(propan-2-yl)-1,3-diazinane-2,4,6-trione;propan-2-amine |
| SMILES | CC(C)N.CC(C)N1C(=O)CC(=O)N(C(C)C)C1=O |
| InChI | InChI=1S/C10H16N2O3.C3H9N/c1-6(2)11-8(13)5-9(14)12(7(3)4)10(11)15;1-3(2)4/h6-7H,5H2,1-4H3;3H,4H2,1-2H3 |
| InChIKey | VBSFKDFQNCRWOV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|