C20H39ClN2O6S2 — CID 161255273
[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methanol;[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl sulfamate;sulfamoyl chloride (PubChem CID 161255273) has the molecular formula C20H39ClN2O6S2 and a molecular weight of 503.13 g/mol. Its IUPAC name is [(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methanol;[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl sulfamate;sulfamoyl chloride.
| Compound Name | [(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methanol;[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl sulfamate;sulfamoyl chloride |
|---|---|
| PubChem CID | 161255273 |
| Molecular Formula | C20H39ClN2O6S2 |
| Molecular Weight | 503.13 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | [(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methanol;[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl sulfamate;sulfamoyl chloride |
| SMILES | CC1(C)[C@H]2CC[C@H](CO)[C@@H]1C2.CC1(C)[C@H]2CC[C@H](COS(N)(=O)=O)[C@@H]1C2.NS(=O)(=O)Cl |
| InChI | InChI=1S/C10H19NO3S.C10H18O.ClH2NO2S/c1-10(2)8-4-3-7(9(10)5-8)6-14-15(11,12)13;1-10(2)8-4-3-7(6-11)9(10)5-8;1-5(2,3)4/h7-9H,3-6H2,1-2H3,(H2,11,12,13);7-9,11H,3-6H2,1-2H3;(H2,2,3,4)/t2*7-,8+,9+;/m11./s1 |
| InChIKey | VBVDWTDKEFVBOC-DRYLBBGHSA-N |
| XLogP | 2.76 |
| TPSA | 149.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.13 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |