About 3,6-dimethoxypyridazine;tributyl-(3,6-dimethoxypyridazin-4-yl)stannane
3,6-dimethoxypyridazine;tributyl-(3,6-dimethoxypyridazin-4-yl)stannane (PubChem CID 161255414) has the molecular formula C24H42N4O4Sn
and a molecular weight of 569.34 g/mol. Its IUPAC name is 3,6-dimethoxypyridazine;tributyl-(3,6-dimethoxypyridazin-4-yl)stannane.
Molecular Properties
| Compound Name | 3,6-dimethoxypyridazine;tributyl-(3,6-dimethoxypyridazin-4-yl)stannane |
| PubChem CID | 161255414 |
| Molecular Formula | C24H42N4O4Sn |
| Molecular Weight | 569.34 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | 3,6-dimethoxypyridazine;tributyl-(3,6-dimethoxypyridazin-4-yl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cc(OC)nnc1OC.COc1ccc(OC)nn1 |
| InChI | InChI=1S/C6H8N2O2.C6H7N2O2.3C4H9.Sn/c2*1-9-5-3-4-6(10-2)8-7-5;3*1-3-4-2;/h3-4H,1-2H3;3H,1-2H3;3*1,3-4H2,2H3; |
| InChIKey | VBVOVJAAMIAUAZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 88.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 569.34 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3,6-dimethoxypyridazine;tributyl-(3,6-dimethoxypyridazin-4-yl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethoxypyridazine;tributyl-(3,6-dimethoxypyridazin-4-yl)stannane?
The IUPAC name of 3,6-dimethoxypyridazine;tributyl-(3,6-dimethoxypyridazin-4-yl)stannane (CID 161255414) is 3,6-dimethoxypyridazine;tributyl-(3,6-dimethoxypyridazin-4-yl)stannane.
What is the SMILES notation for 3,6-dimethoxypyridazine;tributyl-(3,6-dimethoxypyridazin-4-yl)stannane?
The canonical SMILES for 3,6-dimethoxypyridazine;tributyl-(3,6-dimethoxypyridazin-4-yl)stannane is CCCC[Sn](CCCC)(CCCC)c1cc(OC)nnc1OC.COc1ccc(OC)nn1.
What is the InChIKey of 3,6-dimethoxypyridazine;tributyl-(3,6-dimethoxypyridazin-4-yl)stannane?
The InChIKey is VBVOVJAAMIAUAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2.C6H7N2O2.3C4H9.Sn/c2*1-9-5-3-4-6(10-2)8-7-5;3*1-3-4-2;/h3-4H,1-2H3;3H,1-2H3;3*1,3-4H2,2H3;.
What are the key properties of 3,6-dimethoxypyridazine;tributyl-(3,6-dimethoxypyridazin-4-yl)stannane?
3,6-dimethoxypyridazine;tributyl-(3,6-dimethoxypyridazin-4-yl)stannane has a molecular weight of 569.34 g/mol, XLogP of 5.04, 14 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethoxypyridazine;tributyl-(3,6-dimethoxypyridazin-4-yl)stannane is sourced from PubChem (CID 161255414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).