About ethyl(dimethyl)silane;1-trimethylsilylpentan-3-one
ethyl(dimethyl)silane;1-trimethylsilylpentan-3-one (PubChem CID 161255717) has the molecular formula C12H30OSi2
and a molecular weight of 246.54 g/mol. Its IUPAC name is ethyl(dimethyl)silane;1-trimethylsilylpentan-3-one.
Molecular Properties
| Compound Name | ethyl(dimethyl)silane;1-trimethylsilylpentan-3-one |
| PubChem CID | 161255717 |
| Molecular Formula | C12H30OSi2 |
| Molecular Weight | 246.54 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | ethyl(dimethyl)silane;1-trimethylsilylpentan-3-one |
| SMILES | CCC(=O)CC[Si](C)(C)C.CC[SiH](C)C |
| InChI | InChI=1S/C8H18OSi.C4H12Si/c1-5-8(9)6-7-10(2,3)4;1-4-5(2)3/h5-7H2,1-4H3;5H,4H2,1-3H3 |
| InChIKey | VBWQTJHCXIKNMT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl(dimethyl)silane;1-trimethylsilylpentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(dimethyl)silane;1-trimethylsilylpentan-3-one?
The IUPAC name of ethyl(dimethyl)silane;1-trimethylsilylpentan-3-one (CID 161255717) is ethyl(dimethyl)silane;1-trimethylsilylpentan-3-one.
What is the SMILES notation for ethyl(dimethyl)silane;1-trimethylsilylpentan-3-one?
The canonical SMILES for ethyl(dimethyl)silane;1-trimethylsilylpentan-3-one is CCC(=O)CC[Si](C)(C)C.CC[SiH](C)C.
What is the InChIKey of ethyl(dimethyl)silane;1-trimethylsilylpentan-3-one?
The InChIKey is VBWQTJHCXIKNMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18OSi.C4H12Si/c1-5-8(9)6-7-10(2,3)4;1-4-5(2)3/h5-7H2,1-4H3;5H,4H2,1-3H3.
What are the key properties of ethyl(dimethyl)silane;1-trimethylsilylpentan-3-one?
ethyl(dimethyl)silane;1-trimethylsilylpentan-3-one has a molecular weight of 246.54 g/mol, XLogP of 4.19, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(dimethyl)silane;1-trimethylsilylpentan-3-one is sourced from PubChem (CID 161255717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).