C14H13F12N2O7S3+ — CID 161255887
1-butyl-2,3-bis(trifluoromethylsulfonyl)pyridin-1-ium;2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide (PubChem CID 161255887) has the molecular formula C14H13F12N2O7S3+ and a molecular weight of 645.44 g/mol. Its IUPAC name is 1-butyl-2,3-bis(trifluoromethylsulfonyl)pyridin-1-ium;2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide.
| Compound Name | 1-butyl-2,3-bis(trifluoromethylsulfonyl)pyridin-1-ium;2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide |
|---|---|
| PubChem CID | 161255887 |
| Molecular Formula | C14H13F12N2O7S3+ |
| Molecular Weight | 645.44 g/mol |
| Exact Mass | 644.97 |
| IUPAC Name | 1-butyl-2,3-bis(trifluoromethylsulfonyl)pyridin-1-ium;2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide |
| SMILES | CCCC[n+]1cccc(S(=O)(=O)C(F)(F)F)c1S(=O)(=O)C(F)(F)F.O=C(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H12F6NO4S2.C3HF6NO3S/c1-2-3-6-18-7-4-5-8(23(19,20)10(12,13)14)9(18)24(21,22)11(15,16)17;4-2(5,6)1(11)10-14(12,13)3(7,8)9/h4-5,7H,2-3,6H2,1H3;(H,10,11)/q+1; |
| InChIKey | VBXGXQQTSARFSM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|