C46H56N8O4 — CID 161256249
2-N,3-N-bis(4-methylphenyl)pyrazine-2,3-diamine;diethoxymethoxyethane;2-ethoxy-1,3-bis(4-methylphenyl)-2H-imidazo[4,5-b]pyrazine (PubChem CID 161256249) has the molecular formula C46H56N8O4 and a molecular weight of 785.01 g/mol. Its IUPAC name is 2-N,3-N-bis(4-methylphenyl)pyrazine-2,3-diamine;diethoxymethoxyethane;2-ethoxy-1,3-bis(4-methylphenyl)-2H-imidazo[4,5-b]pyrazine.
| Compound Name | 2-N,3-N-bis(4-methylphenyl)pyrazine-2,3-diamine;diethoxymethoxyethane;2-ethoxy-1,3-bis(4-methylphenyl)-2H-imidazo[4,5-b]pyrazine |
|---|---|
| PubChem CID | 161256249 |
| Molecular Formula | C46H56N8O4 |
| Molecular Weight | 785.01 g/mol |
| Exact Mass | 784.44 |
| IUPAC Name | 2-N,3-N-bis(4-methylphenyl)pyrazine-2,3-diamine;diethoxymethoxyethane;2-ethoxy-1,3-bis(4-methylphenyl)-2H-imidazo[4,5-b]pyrazine |
| SMILES | CCOC(OCC)OCC.CCOC1N(c2ccc(C)cc2)c2nccnc2N1c1ccc(C)cc1.Cc1ccc(Nc2nccnc2Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H22N4O.C18H18N4.C7H16O3/c1-4-26-21-24(17-9-5-15(2)6-10-17)19-20(23-14-13-22-19)25(21)18-11-7-16(3)8-12-18;1-13-3-7-15(8-4-13)21-17-18(20-12-11-19-17)22-16-9-5-14(2)6-10-16;1-4-8-7(9-5-2)10-6-3/h5-14,21H,4H2,1-3H3;3-12H,1-2H3,(H,19,21)(H,20,22);7H,4-6H2,1-3H3 |
| InChIKey | VBYLECOKELRQBX-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 119.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.01 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|