About bicyclo[2.2.1]hept-1-ene;propanoic acid
bicyclo[2.2.1]hept-1-ene;propanoic acid (PubChem CID 161257940) has the molecular formula C13H22O4
and a molecular weight of 242.31 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-1-ene;propanoic acid.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hept-1-ene;propanoic acid |
| PubChem CID | 161257940 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | bicyclo[2.2.1]hept-1-ene;propanoic acid |
| SMILES | C1=C2CCC(C1)C2.CCC(=O)O.CCC(=O)O |
| InChI | InChI=1S/C7H10.2C3H6O2/c1-2-7-4-3-6(1)5-7;2*1-2-3(4)5/h1,7H,2-5H2;2*2H2,1H3,(H,4,5) |
| InChIKey | VCEFUXPAAPVUBG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hept-1-ene;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hept-1-ene;propanoic acid?
The IUPAC name of bicyclo[2.2.1]hept-1-ene;propanoic acid (CID 161257940) is bicyclo[2.2.1]hept-1-ene;propanoic acid.
What is the SMILES notation for bicyclo[2.2.1]hept-1-ene;propanoic acid?
The canonical SMILES for bicyclo[2.2.1]hept-1-ene;propanoic acid is C1=C2CCC(C1)C2.CCC(=O)O.CCC(=O)O.
What is the InChIKey of bicyclo[2.2.1]hept-1-ene;propanoic acid?
The InChIKey is VCEFUXPAAPVUBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10.2C3H6O2/c1-2-7-4-3-6(1)5-7;2*1-2-3(4)5/h1,7H,2-5H2;2*2H2,1H3,(H,4,5).
What are the key properties of bicyclo[2.2.1]hept-1-ene;propanoic acid?
bicyclo[2.2.1]hept-1-ene;propanoic acid has a molecular weight of 242.31 g/mol, XLogP of 3.08, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-1-ene;propanoic acid is sourced from PubChem (CID 161257940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).