C20H35NO5 — CID 161258197
9-(3-ethyl-2,5-dioxopyrrolidin-1-yl)-3,6-dimethyldecane-2,5,8-trione;methane (PubChem CID 161258197) has the molecular formula C20H35NO5 and a molecular weight of 369.50 g/mol. Its IUPAC name is 9-(3-ethyl-2,5-dioxopyrrolidin-1-yl)-3,6-dimethyldecane-2,5,8-trione;methane.
| Compound Name | 9-(3-ethyl-2,5-dioxopyrrolidin-1-yl)-3,6-dimethyldecane-2,5,8-trione;methane |
|---|---|
| PubChem CID | 161258197 |
| Molecular Formula | C20H35NO5 |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 9-(3-ethyl-2,5-dioxopyrrolidin-1-yl)-3,6-dimethyldecane-2,5,8-trione;methane |
| SMILES | C.C.CCC1CC(=O)N(C(C)C(=O)CC(C)C(=O)CC(C)C(C)=O)C1=O |
| InChI | InChI=1S/C18H27NO5.2CH4/c1-6-14-9-17(23)19(18(14)24)12(4)16(22)8-11(3)15(21)7-10(2)13(5)20;;/h10-12,14H,6-9H2,1-5H3;2*1H4 |
| InChIKey | VCFBIUUOLZWLFC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|