C17H24N2O3 — CID 161258734
2-(hydroxymethyl)benzoate;2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium (PubChem CID 161258734) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-(hydroxymethyl)benzoate;2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium.
| Compound Name | 2-(hydroxymethyl)benzoate;2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium |
|---|---|
| PubChem CID | 161258734 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 2-(hydroxymethyl)benzoate;2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium |
| SMILES | C1CCC2=[N+](CC1)CCCN2.O=C([O-])c1ccccc1CO |
| InChI | InChI=1S/C9H16N2.C8H8O3/c1-2-5-9-10-6-4-8-11(9)7-3-1;9-5-6-3-1-2-4-7(6)8(10)11/h1-8H2;1-4,9H,5H2,(H,10,11) |
| InChIKey | VCGSXQSWRXUFBI-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|