About methyl 2-methyloxolane-2-carboxylate;2-methyloxolane-2-carboxylic acid
methyl 2-methyloxolane-2-carboxylate;2-methyloxolane-2-carboxylic acid (PubChem CID 161258796) has the molecular formula C13H22O6
and a molecular weight of 274.31 g/mol. Its IUPAC name is methyl 2-methyloxolane-2-carboxylate;2-methyloxolane-2-carboxylic acid.
Molecular Properties
| Compound Name | methyl 2-methyloxolane-2-carboxylate;2-methyloxolane-2-carboxylic acid |
| PubChem CID | 161258796 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | methyl 2-methyloxolane-2-carboxylate;2-methyloxolane-2-carboxylic acid |
| SMILES | CC1(C(=O)O)CCCO1.COC(=O)C1(C)CCCO1 |
| InChI | InChI=1S/C7H12O3.C6H10O3/c1-7(6(8)9-2)4-3-5-10-7;1-6(5(7)8)3-2-4-9-6/h3-5H2,1-2H3;2-4H2,1H3,(H,7,8) |
| InChIKey | VCGWXBXJXHANCZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-methyloxolane-2-carboxylate;2-methyloxolane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methyloxolane-2-carboxylate;2-methyloxolane-2-carboxylic acid?
The IUPAC name of methyl 2-methyloxolane-2-carboxylate;2-methyloxolane-2-carboxylic acid (CID 161258796) is methyl 2-methyloxolane-2-carboxylate;2-methyloxolane-2-carboxylic acid.
What is the SMILES notation for methyl 2-methyloxolane-2-carboxylate;2-methyloxolane-2-carboxylic acid?
The canonical SMILES for methyl 2-methyloxolane-2-carboxylate;2-methyloxolane-2-carboxylic acid is CC1(C(=O)O)CCCO1.COC(=O)C1(C)CCCO1.
What is the InChIKey of methyl 2-methyloxolane-2-carboxylate;2-methyloxolane-2-carboxylic acid?
The InChIKey is VCGWXBXJXHANCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3.C6H10O3/c1-7(6(8)9-2)4-3-5-10-7;1-6(5(7)8)3-2-4-9-6/h3-5H2,1-2H3;2-4H2,1H3,(H,7,8).
What are the key properties of methyl 2-methyloxolane-2-carboxylate;2-methyloxolane-2-carboxylic acid?
methyl 2-methyloxolane-2-carboxylate;2-methyloxolane-2-carboxylic acid has a molecular weight of 274.31 g/mol, XLogP of 1.37, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyloxolane-2-carboxylate;2-methyloxolane-2-carboxylic acid is sourced from PubChem (CID 161258796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).