C37H45BrN3O4S2+ — CID 161259340
3-[(10-benzylacridin-9-ylidene)-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]sulfanylmethyl]sulfanylpropyl-trimethylazanium;hydrobromide (PubChem CID 161259340) has the molecular formula C37H45BrN3O4S2+ and a molecular weight of 739.82 g/mol. Its IUPAC name is 3-[(10-benzylacridin-9-ylidene)-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]sulfanylmethyl]sulfanylpropyl-trimethylazanium;hydrobromide.
| Compound Name | 3-[(10-benzylacridin-9-ylidene)-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]sulfanylmethyl]sulfanylpropyl-trimethylazanium;hydrobromide |
|---|---|
| PubChem CID | 161259340 |
| Molecular Formula | C37H45BrN3O4S2+ |
| Molecular Weight | 739.82 g/mol |
| Exact Mass | 738.20 |
| IUPAC Name | 3-[(10-benzylacridin-9-ylidene)-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]sulfanylmethyl]sulfanylpropyl-trimethylazanium;hydrobromide |
| SMILES | Br.C[N+](C)(C)CCCSC(SCCCCCC(=O)ON1C(=O)CCC1=O)=C1c2ccccc2N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C37H44N3O4S2.BrH/c1-40(2,3)24-14-26-46-37(45-25-13-5-8-21-35(43)44-39-33(41)22-23-34(39)42)36-29-17-9-11-19-31(29)38(27-28-15-6-4-7-16-28)32-20-12-10-18-30(32)36;/h4,6-7,9-12,15-20H,5,8,13-14,21-27H2,1-3H3;1H/q+1; |
| InChIKey | RJRBALIDHLHAFK-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.82 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|