About 1-[(1S,2S)-2-(7-chloro-1-benzofuran-5-carbonyl)cyclopropyl]-2-hydroxyethanone
1-[(1S,2S)-2-(7-chloro-1-benzofuran-5-carbonyl)cyclopropyl]-2-hydroxyethanone (PubChem CID 161260631) has the molecular formula C14H11ClO4
and a molecular weight of 278.69 g/mol. Its IUPAC name is 1-[(1S,2S)-2-(7-chloro-1-benzofuran-5-carbonyl)cyclopropyl]-2-hydroxyethanone.
Molecular Properties
| Compound Name | 1-[(1S,2S)-2-(7-chloro-1-benzofuran-5-carbonyl)cyclopropyl]-2-hydroxyethanone |
| PubChem CID | 161260631 |
| Molecular Formula | C14H11ClO4 |
| Molecular Weight | 278.69 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 1-[(1S,2S)-2-(7-chloro-1-benzofuran-5-carbonyl)cyclopropyl]-2-hydroxyethanone |
| SMILES | O=C(CO)[C@H]1C[C@@H]1C(=O)c1cc(Cl)c2occc2c1 |
| InChI | InChI=1S/C14H11ClO4/c15-11-4-8(3-7-1-2-19-14(7)11)13(18)10-5-9(10)12(17)6-16/h1-4,9-10,16H,5-6H2/t9-,10-/m0/s1 |
| InChIKey | VCMQIRKBEYBLMH-UWVGGRQHSA-N |
| XLogP | 2.47 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.69 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(1S,2S)-2-(7-chloro-1-benzofuran-5-carbonyl)cyclopropyl]-2-hydroxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2S)-2-(7-chloro-1-benzofuran-5-carbonyl)cyclopropyl]-2-hydroxyethanone?
The IUPAC name of 1-[(1S,2S)-2-(7-chloro-1-benzofuran-5-carbonyl)cyclopropyl]-2-hydroxyethanone (CID 161260631) is 1-[(1S,2S)-2-(7-chloro-1-benzofuran-5-carbonyl)cyclopropyl]-2-hydroxyethanone.
What is the SMILES notation for 1-[(1S,2S)-2-(7-chloro-1-benzofuran-5-carbonyl)cyclopropyl]-2-hydroxyethanone?
The canonical SMILES for 1-[(1S,2S)-2-(7-chloro-1-benzofuran-5-carbonyl)cyclopropyl]-2-hydroxyethanone is O=C(CO)[C@H]1C[C@@H]1C(=O)c1cc(Cl)c2occc2c1.
What is the InChIKey of 1-[(1S,2S)-2-(7-chloro-1-benzofuran-5-carbonyl)cyclopropyl]-2-hydroxyethanone?
The InChIKey is VCMQIRKBEYBLMH-UWVGGRQHSA-N. The full InChI is InChI=1S/C14H11ClO4/c15-11-4-8(3-7-1-2-19-14(7)11)13(18)10-5-9(10)12(17)6-16/h1-4,9-10,16H,5-6H2/t9-,10-/m0/s1.
What are the key properties of 1-[(1S,2S)-2-(7-chloro-1-benzofuran-5-carbonyl)cyclopropyl]-2-hydroxyethanone?
1-[(1S,2S)-2-(7-chloro-1-benzofuran-5-carbonyl)cyclopropyl]-2-hydroxyethanone has a molecular weight of 278.69 g/mol, XLogP of 2.47, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2S)-2-(7-chloro-1-benzofuran-5-carbonyl)cyclopropyl]-2-hydroxyethanone is sourced from PubChem (CID 161260631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).