About 6-chloro-4-[(3,6-dimethyl-2-pyridinyl)amino]-N-(trideuteriomethyl)pyridazine-3-carboxamide
6-chloro-4-[(3,6-dimethyl-2-pyridinyl)amino]-N-(trideuteriomethyl)pyridazine-3-carboxamide (PubChem CID 161261168) has the molecular formula C13H14ClN5O
and a molecular weight of 294.76 g/mol. Its IUPAC name is 6-chloro-4-[(3,6-dimethyl-2-pyridinyl)amino]-N-(trideuteriomethyl)pyridazine-3-carboxamide.
Molecular Properties
| Compound Name | 6-chloro-4-[(3,6-dimethyl-2-pyridinyl)amino]-N-(trideuteriomethyl)pyridazine-3-carboxamide |
| PubChem CID | 161261168 |
| Molecular Formula | C13H14ClN5O |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 6-chloro-4-[(3,6-dimethyl-2-pyridinyl)amino]-N-(trideuteriomethyl)pyridazine-3-carboxamide |
| SMILES | [2H]C([2H])([2H])NC(=O)c1nnc(Cl)cc1Nc1nc(C)ccc1C |
| InChI | InChI=1S/C13H14ClN5O/c1-7-4-5-8(2)16-12(7)17-9-6-10(14)18-19-11(9)13(20)15-3/h4-6H,1-3H3,(H,15,20)(H,16,17,18)/i3D3 |
| InChIKey | HSTVXMPCTBCGNC-HPRDVNIFSA-N |
| XLogP | 2.25 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-4-[(3,6-dimethyl-2-pyridinyl)amino]-N-(trideuteriomethyl)pyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-[(3,6-dimethyl-2-pyridinyl)amino]-N-(trideuteriomethyl)pyridazine-3-carboxamide?
The IUPAC name of 6-chloro-4-[(3,6-dimethyl-2-pyridinyl)amino]-N-(trideuteriomethyl)pyridazine-3-carboxamide (CID 161261168) is 6-chloro-4-[(3,6-dimethyl-2-pyridinyl)amino]-N-(trideuteriomethyl)pyridazine-3-carboxamide.
What is the SMILES notation for 6-chloro-4-[(3,6-dimethyl-2-pyridinyl)amino]-N-(trideuteriomethyl)pyridazine-3-carboxamide?
The canonical SMILES for 6-chloro-4-[(3,6-dimethyl-2-pyridinyl)amino]-N-(trideuteriomethyl)pyridazine-3-carboxamide is [2H]C([2H])([2H])NC(=O)c1nnc(Cl)cc1Nc1nc(C)ccc1C.
What is the InChIKey of 6-chloro-4-[(3,6-dimethyl-2-pyridinyl)amino]-N-(trideuteriomethyl)pyridazine-3-carboxamide?
The InChIKey is HSTVXMPCTBCGNC-HPRDVNIFSA-N. The full InChI is InChI=1S/C13H14ClN5O/c1-7-4-5-8(2)16-12(7)17-9-6-10(14)18-19-11(9)13(20)15-3/h4-6H,1-3H3,(H,15,20)(H,16,17,18)/i3D3.
What are the key properties of 6-chloro-4-[(3,6-dimethyl-2-pyridinyl)amino]-N-(trideuteriomethyl)pyridazine-3-carboxamide?
6-chloro-4-[(3,6-dimethyl-2-pyridinyl)amino]-N-(trideuteriomethyl)pyridazine-3-carboxamide has a molecular weight of 294.76 g/mol, XLogP of 2.25, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-[(3,6-dimethyl-2-pyridinyl)amino]-N-(trideuteriomethyl)pyridazine-3-carboxamide is sourced from PubChem (CID 161261168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).