C16H24F15NO — CID 161261958
deuterium monohydride;heptan-1-amine;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-8-methoxyoctane (PubChem CID 161261958) has the molecular formula C16H24F15NO and a molecular weight of 532.35 g/mol. Its IUPAC name is deuterium monohydride;heptan-1-amine;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-8-methoxyoctane.
| Compound Name | deuterium monohydride;heptan-1-amine;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-8-methoxyoctane |
|---|---|
| PubChem CID | 161261958 |
| Molecular Formula | C16H24F15NO |
| Molecular Weight | 532.35 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | deuterium monohydride;heptan-1-amine;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-8-methoxyoctane |
| SMILES | CCCCCCCN.COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[H][2H] |
| InChI | InChI=1S/C9H5F15O.C7H17N.H2/c1-25-2-3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)24;1-2-3-4-5-6-7-8;/h2H2,1H3;2-8H2,1H3;1H/i;;1+1 |
| InChIKey | VCRACVOLMZCPDZ-FCHARDOESA-N |
| XLogP | 7.17 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.35 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|