1-methyl-1H-tetrazol-1-ium chloride

C2H5ClN4 — CID 161262104

IUPAC1-methyl-1H-tetrazol-1-ium chloride
SMILESC[NH+]1C=NN=N1.[Cl-]
InChIInChI=1S/C2H4N4.ClH/c1-6-2-3-4-5-6;/h2H,1H3;1H
InChIKeyVCRNCUPWJSUPPT-UHFFFAOYSA-N
MW120.54 g/mol
LogP-4.17
Rot. Bonds

About 1-methyl-1H-tetrazol-1-ium chloride

1-methyl-1H-tetrazol-1-ium chloride (PubChem CID 161262104) has the molecular formula C2H5ClN4 and a molecular weight of 120.54 g/mol. Its IUPAC name is 1-methyl-1H-tetrazol-1-ium chloride.

Molecular Properties

Compound Name1-methyl-1H-tetrazol-1-ium chloride
PubChem CID161262104
Molecular FormulaC2H5ClN4
Molecular Weight120.54 g/mol
Exact Mass120.02
IUPAC Name1-methyl-1H-tetrazol-1-ium chloride
SMILESC[NH+]1C=NN=N1.[Cl-]
InChIInChI=1S/C2H4N4.ClH/c1-6-2-3-4-5-6;/h2H,1H3;1H
InChIKeyVCRNCUPWJSUPPT-UHFFFAOYSA-N
XLogP-4.17
TPSA41.52 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500120.54
LogP ≤ 5-4.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-methyl-1H-tetrazol-1-ium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methyl-1H-tetrazol-1-ium chloride?
The IUPAC name of 1-methyl-1H-tetrazol-1-ium chloride (CID 161262104) is 1-methyl-1H-tetrazol-1-ium chloride.
What is the SMILES notation for 1-methyl-1H-tetrazol-1-ium chloride?
The canonical SMILES for 1-methyl-1H-tetrazol-1-ium chloride is C[NH+]1C=NN=N1.[Cl-].
What is the InChIKey of 1-methyl-1H-tetrazol-1-ium chloride?
The InChIKey is VCRNCUPWJSUPPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4N4.ClH/c1-6-2-3-4-5-6;/h2H,1H3;1H.
What are the key properties of 1-methyl-1H-tetrazol-1-ium chloride?
1-methyl-1H-tetrazol-1-ium chloride has a molecular weight of 120.54 g/mol, XLogP of -4.17, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1H-tetrazol-1-ium chloride is sourced from PubChem (CID 161262104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).