C29H20ClF6N5O4 — CID 161262504
ethyl 4-chloro-5-cyano-1-(2,2,2-trifluoroethyl)indole-2-carboxylate;ethyl 4,5-dicyano-1-(2,2,2-trifluoroethyl)indole-2-carboxylate (PubChem CID 161262504) has the molecular formula C29H20ClF6N5O4 and a molecular weight of 651.95 g/mol. Its IUPAC name is ethyl 4-chloro-5-cyano-1-(2,2,2-trifluoroethyl)indole-2-carboxylate;ethyl 4,5-dicyano-1-(2,2,2-trifluoroethyl)indole-2-carboxylate.
| Compound Name | ethyl 4-chloro-5-cyano-1-(2,2,2-trifluoroethyl)indole-2-carboxylate;ethyl 4,5-dicyano-1-(2,2,2-trifluoroethyl)indole-2-carboxylate |
|---|---|
| PubChem CID | 161262504 |
| Molecular Formula | C29H20ClF6N5O4 |
| Molecular Weight | 651.95 g/mol |
| Exact Mass | 651.11 |
| IUPAC Name | ethyl 4-chloro-5-cyano-1-(2,2,2-trifluoroethyl)indole-2-carboxylate;ethyl 4,5-dicyano-1-(2,2,2-trifluoroethyl)indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(C#N)c(C#N)ccc2n1CC(F)(F)F.CCOC(=O)c1cc2c(Cl)c(C#N)ccc2n1CC(F)(F)F |
| InChI | InChI=1S/C15H10F3N3O2.C14H10ClF3N2O2/c1-2-23-14(22)13-5-10-11(7-20)9(6-19)3-4-12(10)21(13)8-15(16,17)18;1-2-22-13(21)11-5-9-10(20(11)7-14(16,17)18)4-3-8(6-19)12(9)15/h3-5H,2,8H2,1H3;3-5H,2,7H2,1H3 |
| InChIKey | VCSXWEOGTQAFTJ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 133.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.95 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |