About 2-benzoselenophene-1,3-dicarbonitrile;2-benzoselenophene-1,3-dicarboxamide
2-benzoselenophene-1,3-dicarbonitrile;2-benzoselenophene-1,3-dicarboxamide (PubChem CID 161262643) has the molecular formula C20H12N4O2Se2
and a molecular weight of 498.26 g/mol. Its IUPAC name is 2-benzoselenophene-1,3-dicarbonitrile;2-benzoselenophene-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 2-benzoselenophene-1,3-dicarbonitrile;2-benzoselenophene-1,3-dicarboxamide |
| PubChem CID | 161262643 |
| Molecular Formula | C20H12N4O2Se2 |
| Molecular Weight | 498.26 g/mol |
| Exact Mass | 499.93 |
| IUPAC Name | 2-benzoselenophene-1,3-dicarbonitrile;2-benzoselenophene-1,3-dicarboxamide |
| SMILES | N#Cc1[se]c(C#N)c2ccccc12.NC(=O)c1[se]c(C(N)=O)c2ccccc12 |
| InChI | InChI=1S/C10H8N2O2Se.C10H4N2Se/c11-9(13)7-5-3-1-2-4-6(5)8(15-7)10(12)14;11-5-9-7-3-1-2-4-8(7)10(6-12)13-9/h1-4H,(H2,11,13)(H2,12,14);1-4H |
| InChIKey | VCTKTGYVULQERU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 133.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 498.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-benzoselenophene-1,3-dicarbonitrile;2-benzoselenophene-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzoselenophene-1,3-dicarbonitrile;2-benzoselenophene-1,3-dicarboxamide?
The IUPAC name of 2-benzoselenophene-1,3-dicarbonitrile;2-benzoselenophene-1,3-dicarboxamide (CID 161262643) is 2-benzoselenophene-1,3-dicarbonitrile;2-benzoselenophene-1,3-dicarboxamide.
What is the SMILES notation for 2-benzoselenophene-1,3-dicarbonitrile;2-benzoselenophene-1,3-dicarboxamide?
The canonical SMILES for 2-benzoselenophene-1,3-dicarbonitrile;2-benzoselenophene-1,3-dicarboxamide is N#Cc1[se]c(C#N)c2ccccc12.NC(=O)c1[se]c(C(N)=O)c2ccccc12.
What is the InChIKey of 2-benzoselenophene-1,3-dicarbonitrile;2-benzoselenophene-1,3-dicarboxamide?
The InChIKey is VCTKTGYVULQERU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2Se.C10H4N2Se/c11-9(13)7-5-3-1-2-4-6(5)8(15-7)10(12)14;11-5-9-7-3-1-2-4-8(7)10(6-12)13-9/h1-4H,(H2,11,13)(H2,12,14);1-4H.
What are the key properties of 2-benzoselenophene-1,3-dicarbonitrile;2-benzoselenophene-1,3-dicarboxamide?
2-benzoselenophene-1,3-dicarbonitrile;2-benzoselenophene-1,3-dicarboxamide has a molecular weight of 498.26 g/mol, XLogP of 1.73, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzoselenophene-1,3-dicarbonitrile;2-benzoselenophene-1,3-dicarboxamide is sourced from PubChem (CID 161262643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).