About [2-(bromomethyl)cyclopent-2-en-1-yl]methoxy-tert-butyl-dimethylsilane;tetrabromomethane
[2-(bromomethyl)cyclopent-2-en-1-yl]methoxy-tert-butyl-dimethylsilane;tetrabromomethane (PubChem CID 161262935) has the molecular formula C14H25Br5OSi
and a molecular weight of 636.96 g/mol. Its IUPAC name is [2-(bromomethyl)cyclopent-2-en-1-yl]methoxy-tert-butyl-dimethylsilane;tetrabromomethane.
Molecular Properties
| Compound Name | [2-(bromomethyl)cyclopent-2-en-1-yl]methoxy-tert-butyl-dimethylsilane;tetrabromomethane |
| PubChem CID | 161262935 |
| Molecular Formula | C14H25Br5OSi |
| Molecular Weight | 636.96 g/mol |
| Exact Mass | 631.76 |
| IUPAC Name | [2-(bromomethyl)cyclopent-2-en-1-yl]methoxy-tert-butyl-dimethylsilane;tetrabromomethane |
| SMILES | BrC(Br)(Br)Br.CC(C)(C)[Si](C)(C)OCC1CCC=C1CBr |
| InChI | InChI=1S/C13H25BrOSi.CBr4/c1-13(2,3)16(4,5)15-10-12-8-6-7-11(12)9-14;2-1(3,4)5/h7,12H,6,8-10H2,1-5H3; |
| InChIKey | VCUKLJOGCLJKPA-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 636.96 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-(bromomethyl)cyclopent-2-en-1-yl]methoxy-tert-butyl-dimethylsilane;tetrabromomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(bromomethyl)cyclopent-2-en-1-yl]methoxy-tert-butyl-dimethylsilane;tetrabromomethane?
The IUPAC name of [2-(bromomethyl)cyclopent-2-en-1-yl]methoxy-tert-butyl-dimethylsilane;tetrabromomethane (CID 161262935) is [2-(bromomethyl)cyclopent-2-en-1-yl]methoxy-tert-butyl-dimethylsilane;tetrabromomethane.
What is the SMILES notation for [2-(bromomethyl)cyclopent-2-en-1-yl]methoxy-tert-butyl-dimethylsilane;tetrabromomethane?
The canonical SMILES for [2-(bromomethyl)cyclopent-2-en-1-yl]methoxy-tert-butyl-dimethylsilane;tetrabromomethane is BrC(Br)(Br)Br.CC(C)(C)[Si](C)(C)OCC1CCC=C1CBr.
What is the InChIKey of [2-(bromomethyl)cyclopent-2-en-1-yl]methoxy-tert-butyl-dimethylsilane;tetrabromomethane?
The InChIKey is VCUKLJOGCLJKPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25BrOSi.CBr4/c1-13(2,3)16(4,5)15-10-12-8-6-7-11(12)9-14;2-1(3,4)5/h7,12H,6,8-10H2,1-5H3;.
What are the key properties of [2-(bromomethyl)cyclopent-2-en-1-yl]methoxy-tert-butyl-dimethylsilane;tetrabromomethane?
[2-(bromomethyl)cyclopent-2-en-1-yl]methoxy-tert-butyl-dimethylsilane;tetrabromomethane has a molecular weight of 636.96 g/mol, XLogP of 7.92, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(bromomethyl)cyclopent-2-en-1-yl]methoxy-tert-butyl-dimethylsilane;tetrabromomethane is sourced from PubChem (CID 161262935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).