C39H38N4O2 — CID 161262985
N-[2-[1-(dimethylamino)-2,3-dihydro-1H-inden-5-yl]propan-2-yl]-9-oxo-10H-acridine-3-carboxamide;6-isocyano-3-methylidene-1,2-dihydroindene (PubChem CID 161262985) has the molecular formula C39H38N4O2 and a molecular weight of 594.76 g/mol. Its IUPAC name is N-[2-[1-(dimethylamino)-2,3-dihydro-1H-inden-5-yl]propan-2-yl]-9-oxo-10H-acridine-3-carboxamide;6-isocyano-3-methylidene-1,2-dihydroindene.
| Compound Name | N-[2-[1-(dimethylamino)-2,3-dihydro-1H-inden-5-yl]propan-2-yl]-9-oxo-10H-acridine-3-carboxamide;6-isocyano-3-methylidene-1,2-dihydroindene |
|---|---|
| PubChem CID | 161262985 |
| Molecular Formula | C39H38N4O2 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | N-[2-[1-(dimethylamino)-2,3-dihydro-1H-inden-5-yl]propan-2-yl]-9-oxo-10H-acridine-3-carboxamide;6-isocyano-3-methylidene-1,2-dihydroindene |
| SMILES | CN(C)C1CCc2cc(C(C)(C)NC(=O)c3ccc4c(=O)c5ccccc5[nH]c4c3)ccc21.[C-]#[N+]c1ccc2c(c1)CCC2=C |
| InChI | InChI=1S/C28H29N3O2.C11H9N/c1-28(2,19-11-13-20-17(15-19)10-14-25(20)31(3)4)30-27(33)18-9-12-22-24(16-18)29-23-8-6-5-7-21(23)26(22)32;1-8-3-4-9-7-10(12-2)5-6-11(8)9/h5-9,11-13,15-16,25H,10,14H2,1-4H3,(H,29,32)(H,30,33);5-7H,1,3-4H2 |
| InChIKey | VCUNSAODQSPZLK-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|