C27H36N2O2 — CID 161264480
3-[3-[2-(4-cyclohexyl-3-methylbutyl)phenoxy]propyl]-1H-benzimidazol-2-one (PubChem CID 161264480) has the molecular formula C27H36N2O2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 3-[3-[2-(4-cyclohexyl-3-methylbutyl)phenoxy]propyl]-1H-benzimidazol-2-one.
| Compound Name | 3-[3-[2-(4-cyclohexyl-3-methylbutyl)phenoxy]propyl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 161264480 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 3-[3-[2-(4-cyclohexyl-3-methylbutyl)phenoxy]propyl]-1H-benzimidazol-2-one |
| SMILES | CC(CCc1ccccc1OCCCn1c(=O)[nH]c2ccccc21)CC1CCCCC1 |
| InChI | InChI=1S/C27H36N2O2/c1-21(20-22-10-3-2-4-11-22)16-17-23-12-5-8-15-26(23)31-19-9-18-29-25-14-7-6-13-24(25)28-27(29)30/h5-8,12-15,21-22H,2-4,9-11,16-20H2,1H3,(H,28,30) |
| InChIKey | VCZJWWMFBZHUAK-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|