C23H28F3N5O2 — CID 161267175
N-butyl-3-[4-(pyrrolidin-1-ylmethyl)phenyl]imidazo[1,2-b]pyridazin-6-amine;2,2,2-trifluoroacetic acid (PubChem CID 161267175) has the molecular formula C23H28F3N5O2 and a molecular weight of 463.50 g/mol. Its IUPAC name is N-butyl-3-[4-(pyrrolidin-1-ylmethyl)phenyl]imidazo[1,2-b]pyridazin-6-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-butyl-3-[4-(pyrrolidin-1-ylmethyl)phenyl]imidazo[1,2-b]pyridazin-6-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 161267175 |
| Molecular Formula | C23H28F3N5O2 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | N-butyl-3-[4-(pyrrolidin-1-ylmethyl)phenyl]imidazo[1,2-b]pyridazin-6-amine;2,2,2-trifluoroacetic acid |
| SMILES | CCCCNc1ccc2ncc(-c3ccc(CN4CCCC4)cc3)n2n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H27N5.C2HF3O2/c1-2-3-12-22-20-10-11-21-23-15-19(26(21)24-20)18-8-6-17(7-9-18)16-25-13-4-5-14-25;3-2(4,5)1(6)7/h6-11,15H,2-5,12-14,16H2,1H3,(H,22,24);(H,6,7) |
| InChIKey | VDILQSZXEVWLNG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|