About 1-tert-butylpiperidine;4-tert-butylpiperidine
1-tert-butylpiperidine;4-tert-butylpiperidine (PubChem CID 161268156) has the molecular formula C18H38N2
and a molecular weight of 282.52 g/mol. Its IUPAC name is 1-tert-butylpiperidine;4-tert-butylpiperidine.
Molecular Properties
| Compound Name | 1-tert-butylpiperidine;4-tert-butylpiperidine |
| PubChem CID | 161268156 |
| Molecular Formula | C18H38N2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.30 |
| IUPAC Name | 1-tert-butylpiperidine;4-tert-butylpiperidine |
| SMILES | CC(C)(C)C1CCNCC1.CC(C)(C)N1CCCCC1 |
| InChI | InChI=1S/2C9H19N/c1-9(2,3)8-4-6-10-7-5-8;1-9(2,3)10-7-5-4-6-8-10/h8,10H,4-7H2,1-3H3;4-8H2,1-3H3 |
| InChIKey | VDLONVVEDNTUJC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butylpiperidine;4-tert-butylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylpiperidine;4-tert-butylpiperidine?
The IUPAC name of 1-tert-butylpiperidine;4-tert-butylpiperidine (CID 161268156) is 1-tert-butylpiperidine;4-tert-butylpiperidine.
What is the SMILES notation for 1-tert-butylpiperidine;4-tert-butylpiperidine?
The canonical SMILES for 1-tert-butylpiperidine;4-tert-butylpiperidine is CC(C)(C)C1CCNCC1.CC(C)(C)N1CCCCC1.
What is the InChIKey of 1-tert-butylpiperidine;4-tert-butylpiperidine?
The InChIKey is VDLONVVEDNTUJC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H19N/c1-9(2,3)8-4-6-10-7-5-8;1-9(2,3)10-7-5-4-6-8-10/h8,10H,4-7H2,1-3H3;4-8H2,1-3H3.
What are the key properties of 1-tert-butylpiperidine;4-tert-butylpiperidine?
1-tert-butylpiperidine;4-tert-butylpiperidine has a molecular weight of 282.52 g/mol, XLogP of 4.30, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylpiperidine;4-tert-butylpiperidine is sourced from PubChem (CID 161268156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).