C17H19F3N4O2S — CID 161269784
(6R,7R)-6-hydroxy-1-[1-(5-methyl-1,3,4-thiadiazol-2-yl)piperidin-4-yl]-7-(trifluoromethyl)-3,4,6,7-tetrahydroisoindol-5-one (PubChem CID 161269784) has the molecular formula C17H19F3N4O2S and a molecular weight of 400.43 g/mol. Its IUPAC name is (6R,7R)-6-hydroxy-1-[1-(5-methyl-1,3,4-thiadiazol-2-yl)piperidin-4-yl]-7-(trifluoromethyl)-3,4,6,7-tetrahydroisoindol-5-one.
| Compound Name | (6R,7R)-6-hydroxy-1-[1-(5-methyl-1,3,4-thiadiazol-2-yl)piperidin-4-yl]-7-(trifluoromethyl)-3,4,6,7-tetrahydroisoindol-5-one |
|---|---|
| PubChem CID | 161269784 |
| Molecular Formula | C17H19F3N4O2S |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | (6R,7R)-6-hydroxy-1-[1-(5-methyl-1,3,4-thiadiazol-2-yl)piperidin-4-yl]-7-(trifluoromethyl)-3,4,6,7-tetrahydroisoindol-5-one |
| SMILES | Cc1nnc(N2CCC(C3=NCC4=C3[C@@H](C(F)(F)F)[C@@H](O)C(=O)C4)CC2)s1 |
| InChI | InChI=1S/C17H19F3N4O2S/c1-8-22-23-16(27-8)24-4-2-9(3-5-24)14-12-10(7-21-14)6-11(25)15(26)13(12)17(18,19)20/h9,13,15,26H,2-7H2,1H3/t13-,15+/m1/s1 |
| InChIKey | VDQUGPIEAFKDIS-HIFRSBDPSA-N |
| XLogP | 2.33 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |