C46H60N2O2 — CID 161270562
N-ethyl-5-methyl-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)pyridin-2-amine;methane;4-[1-(1,1,3,3,6-pentamethyl-2H-inden-5-yl)ethenyl]benzoic acid (PubChem CID 161270562) has the molecular formula C46H60N2O2 and a molecular weight of 673.00 g/mol. Its IUPAC name is N-ethyl-5-methyl-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)pyridin-2-amine;methane;4-[1-(1,1,3,3,6-pentamethyl-2H-inden-5-yl)ethenyl]benzoic acid.
| Compound Name | N-ethyl-5-methyl-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)pyridin-2-amine;methane;4-[1-(1,1,3,3,6-pentamethyl-2H-inden-5-yl)ethenyl]benzoic acid |
|---|---|
| PubChem CID | 161270562 |
| Molecular Formula | C46H60N2O2 |
| Molecular Weight | 673.00 g/mol |
| Exact Mass | 672.47 |
| IUPAC Name | N-ethyl-5-methyl-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)pyridin-2-amine;methane;4-[1-(1,1,3,3,6-pentamethyl-2H-inden-5-yl)ethenyl]benzoic acid |
| SMILES | C.C=C(c1ccc(C(=O)O)cc1)c1cc2c(cc1C)C(C)(C)CC2(C)C.CCN(c1ccc2c(c1)C(C)(C)CCC2(C)C)c1ccc(C)cn1 |
| InChI | InChI=1S/C23H26O2.C22H30N2.CH4/c1-14-11-19-20(23(5,6)13-22(19,3)4)12-18(14)15(2)16-7-9-17(10-8-16)21(24)25;1-7-24(20-11-8-16(2)15-23-20)17-9-10-18-19(14-17)22(5,6)13-12-21(18,3)4;/h7-12H,2,13H2,1,3-6H3,(H,24,25);8-11,14-15H,7,12-13H2,1-6H3;1H4 |
| InChIKey | VDTGJLYKJWEQII-UHFFFAOYSA-N |
| XLogP | 12.25 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.00 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |